![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. Introduction.docx | 2021-06-22 19:08 | 13K | |
| 2. Literature review.docx | 2021-06-20 01:35 | 35K | |
| CircularityAccounting_AF_23Jun2021_Due10Nov21.docx | 2021-06-22 20:31 | 514K | |
| Co2 Accounting structure.xmind | 2021-06-08 00:53 | 162K | |
| Comments and Feedback to Circularity Accounting.pptx | 2021-06-03 20:31 | 547K | |
| Due 10Nov21_AF_SI_Review_A_Circularity_Accounting_Model_0521_outlook.pdf | 2021-05-13 21:50 | 77K | |
| Latour on Beck_Theory Culture and Society.pdf | 2021-06-10 04:34 | 48K | |
| Martin et al.2020.pdf | 2021-06-10 02:45 | 1.0M | |
| Rekker-2016-ConvertingPBsintoaction.pdf | 2021-06-10 02:45 | 388K | |
| Robson and Bottausci 2018 CPA on Latour.pdf | 2021-06-09 21:56 | 298K | |
| Structure of the paper (with comments for consider).docx | 2021-06-12 19:07 | 22K | |